C24H27BN6O — CID 89198415
CID 89198415 (PubChem CID 89198415) has the molecular formula C24H27BN6O and a molecular weight of 426.33 g/mol.
| Compound Name | CID 89198415 |
|---|---|
| PubChem CID | 89198415 |
| Molecular Formula | C24H27BN6O |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCCc1ccccc1 |
| InChI | InChI=1S/C24H27BN6O/c25-21-17-27-23(30-22(21)26-13-7-10-18-8-2-1-3-9-18)28-19-11-6-12-20(16-19)29-24(32)31-14-4-5-15-31/h1-3,6,8-9,11-12,16-17H,4-5,7,10,13-15H2,(H,29,32)(H2,26,27,28,30) |
| InChIKey | QZCYGRQRTVRCCO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|