C21H22BN7O — CID 89198527
CID 89198527 (PubChem CID 89198527) has the molecular formula C21H22BN7O and a molecular weight of 399.27 g/mol.
| Compound Name | CID 89198527 |
|---|---|
| PubChem CID | 89198527 |
| Molecular Formula | C21H22BN7O |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCc1ccccn1 |
| InChI | InChI=1S/C21H22BN7O/c22-18-14-25-20(28-19(18)24-13-17-6-1-2-9-23-17)26-15-7-5-8-16(12-15)27-21(30)29-10-3-4-11-29/h1-2,5-9,12,14H,3-4,10-11,13H2,(H,27,30)(H2,24,25,26,28) |
| InChIKey | LHXJGABQROUQAO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|