C25H28BN7O3S — CID 89198389
CID 89198389 (PubChem CID 89198389) has the molecular formula C25H28BN7O3S and a molecular weight of 517.42 g/mol.
| Compound Name | CID 89198389 |
|---|---|
| PubChem CID | 89198389 |
| Molecular Formula | C25H28BN7O3S |
| Molecular Weight | 517.42 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCCNC(=O)c1ccc(C(C)=O)s1 |
| InChI | InChI=1S/C25H28BN7O3S/c1-16(34)20-8-9-21(37-20)23(35)28-11-5-10-27-22-19(26)15-29-24(32-22)30-17-6-4-7-18(14-17)31-25(36)33-12-2-3-13-33/h4,6-9,14-15H,2-3,5,10-13H2,1H3,(H,28,35)(H,31,36)(H2,27,29,30,32) |
| InChIKey | QJLBSWJWEIDZQY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 128.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|