C25H35BN8O3S — CID 89198503
CID 89198503 (PubChem CID 89198503) has the molecular formula C25H35BN8O3S and a molecular weight of 538.49 g/mol.
| Compound Name | CID 89198503 |
|---|---|
| PubChem CID | 89198503 |
| Molecular Formula | C25H35BN8O3S |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCCNC(=O)C(CCSC)NC(C)=O |
| InChI | InChI=1S/C25H35BN8O3S/c1-17(35)30-21(9-14-38-2)23(36)28-11-6-10-27-22-20(26)16-29-24(33-22)31-18-7-5-8-19(15-18)32-25(37)34-12-3-4-13-34/h5,7-8,15-16,21H,3-4,6,9-14H2,1-2H3,(H,28,36)(H,30,35)(H,32,37)(H2,27,29,31,33) |
| InChIKey | WGRSCAZZMJCWMM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 140.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|