C22H30BN7O — CID 89198479
CID 89198479 (PubChem CID 89198479) has the molecular formula C22H30BN7O and a molecular weight of 419.34 g/mol.
| Compound Name | CID 89198479 |
|---|---|
| PubChem CID | 89198479 |
| Molecular Formula | C22H30BN7O |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCCN1CCCC1 |
| InChI | InChI=1S/C22H30BN7O/c23-19-16-25-21(28-20(19)24-9-6-12-29-10-1-2-11-29)26-17-7-5-8-18(15-17)27-22(31)30-13-3-4-14-30/h5,7-8,15-16H,1-4,6,9-14H2,(H,27,31)(H2,24,25,26,28) |
| InChIKey | LWLYYKUWFBEDDD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|