C19H25N5O3 — CID 143493345
5-hydroxy-2-(3-methoxyanilino)-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-4-carboxamide (PubChem CID 143493345) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 5-hydroxy-2-(3-methoxyanilino)-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-2-(3-methoxyanilino)-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 143493345 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 5-hydroxy-2-(3-methoxyanilino)-N-(3-pyrrolidin-1-ylpropyl)pyrimidine-4-carboxamide |
| SMILES | COc1cccc(Nc2ncc(O)c(C(=O)NCCCN3CCCC3)n2)c1 |
| InChI | InChI=1S/C19H25N5O3/c1-27-15-7-4-6-14(12-15)22-19-21-13-16(25)17(23-19)18(26)20-8-5-11-24-9-2-3-10-24/h4,6-7,12-13,25H,2-3,5,8-11H2,1H3,(H,20,26)(H,21,22,23) |
| InChIKey | DLMMUYGQIPVSKR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|