C23H28BrN7OS — CID 68818603
N-[3-[[5-bromo-4-[3-(thiophen-3-ylmethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide (PubChem CID 68818603) has the molecular formula C23H28BrN7OS and a molecular weight of 530.50 g/mol. Its IUPAC name is N-[3-[[5-bromo-4-[3-(thiophen-3-ylmethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-[[5-bromo-4-[3-(thiophen-3-ylmethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 68818603 |
| Molecular Formula | C23H28BrN7OS |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | N-[3-[[5-bromo-4-[3-(thiophen-3-ylmethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(Nc2ncc(Br)c(NCCCNCc3ccsc3)n2)c1)N1CCCC1 |
| InChI | InChI=1S/C23H28BrN7OS/c24-20-15-27-22(30-21(20)26-9-4-8-25-14-17-7-12-33-16-17)28-18-5-3-6-19(13-18)29-23(32)31-10-1-2-11-31/h3,5-7,12-13,15-16,25H,1-2,4,8-11,14H2,(H,29,32)(H2,26,27,28,30) |
| InChIKey | UCNLJCRBVZFONO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|