C26H28BN7O2 — CID 89198480
CID 89198480 (PubChem CID 89198480) has the molecular formula C26H28BN7O2 and a molecular weight of 481.37 g/mol.
| Compound Name | CID 89198480 |
|---|---|
| PubChem CID | 89198480 |
| Molecular Formula | C26H28BN7O2 |
| Molecular Weight | 481.37 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2cccc(NC(=O)N3CCCC3)c2)nc1NCCc1c[nH]c2cc(OC)ccc12 |
| InChI | InChI=1S/C26H28BN7O2/c1-36-20-7-8-21-17(15-29-23(21)14-20)9-10-28-24-22(27)16-30-25(33-24)31-18-5-4-6-19(13-18)32-26(35)34-11-2-3-12-34/h4-8,13-16,29H,2-3,9-12H2,1H3,(H,32,35)(H2,28,30,31,33) |
| InChIKey | XRHDMQKFIUWLSO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|