C21H25F3N6O2 — CID 21081220
N-[2-[[2-[3-(piperidine-1-carbonyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21081220) has the molecular formula C21H25F3N6O2 and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[2-[[2-[3-(piperidine-1-carbonyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[3-(piperidine-1-carbonyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21081220 |
| Molecular Formula | C21H25F3N6O2 |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-[2-[[2-[3-(piperidine-1-carbonyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(Nc2cccc(C(=O)N3CCCCC3)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C21H25F3N6O2/c1-14(31)25-8-9-26-18-17(21(22,23)24)13-27-20(29-18)28-16-7-5-6-15(12-16)19(32)30-10-3-2-4-11-30/h5-7,12-13H,2-4,8-11H2,1H3,(H,25,31)(H2,26,27,28,29) |
| InChIKey | OZKBPSQCNRRWML-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|