C17H19F3N6O2 — CID 21081200
N-[2-[[2-(3-acetamidoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21081200) has the molecular formula C17H19F3N6O2 and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[2-[[2-(3-acetamidoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(3-acetamidoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21081200 |
| Molecular Formula | C17H19F3N6O2 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[2-[[2-(3-acetamidoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(Nc2cccc(NC(C)=O)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N6O2/c1-10(27)21-6-7-22-15-14(17(18,19)20)9-23-16(26-15)25-13-5-3-4-12(8-13)24-11(2)28/h3-5,8-9H,6-7H2,1-2H3,(H,21,27)(H,24,28)(H2,22,23,25,26) |
| InChIKey | FRLRVMRIZOIVKG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|