C19H25F3N6O2 — CID 177203955
tert-butyl N-[3-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]carbamate (PubChem CID 177203955) has the molecular formula C19H25F3N6O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 177203955 |
| Molecular Formula | C19H25F3N6O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | tert-butyl N-[3-[[4-(3-aminopropylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2ncc(C(F)(F)F)c(NCCCN)n2)c1 |
| InChI | InChI=1S/C19H25F3N6O2/c1-18(2,3)30-17(29)27-13-7-4-6-12(10-13)26-16-25-11-14(19(20,21)22)15(28-16)24-9-5-8-23/h4,6-7,10-11H,5,8-9,23H2,1-3H3,(H,27,29)(H2,24,25,26,28) |
| InChIKey | KCTVXRFOGYKWLE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|