C16H18FIN4O2 — CID 89434791
tert-butyl N-[3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]phenyl]carbamate (PubChem CID 89434791) has the molecular formula C16H18FIN4O2 and a molecular weight of 444.25 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 89434791 |
| Molecular Formula | C16H18FIN4O2 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | tert-butyl N-[3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2nc(CI)ncc2F)c1 |
| InChI | InChI=1S/C16H18FIN4O2/c1-16(2,3)24-15(23)21-11-6-4-5-10(7-11)20-14-12(17)9-19-13(8-18)22-14/h4-7,9H,8H2,1-3H3,(H,21,23)(H,19,20,22) |
| InChIKey | YKLIQYGYKIOIDN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|