C13H11FIN3O2 — CID 89434786
methyl 3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 89434786) has the molecular formula C13H11FIN3O2 and a molecular weight of 387.15 g/mol. Its IUPAC name is methyl 3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 89434786 |
| Molecular Formula | C13H11FIN3O2 |
| Molecular Weight | 387.15 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | methyl 3-[[5-fluoro-2-(iodomethyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(CI)ncc2F)c1 |
| InChI | InChI=1S/C13H11FIN3O2/c1-20-13(19)8-3-2-4-9(5-8)17-12-10(14)7-16-11(6-15)18-12/h2-5,7H,6H2,1H3,(H,16,17,18) |
| InChIKey | XEDSTSSZBCRXPF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|