C15H19ClN6O2 — CID 141416560
tert-butyl N-[3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]phenyl]carbamate (PubChem CID 141416560) has the molecular formula C15H19ClN6O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 141416560 |
| Molecular Formula | C15H19ClN6O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | tert-butyl N-[3-[(5-chloro-2-hydrazinylpyrimidin-4-yl)amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2nc(NN)ncc2Cl)c1 |
| InChI | InChI=1S/C15H19ClN6O2/c1-15(2,3)24-14(23)20-10-6-4-5-9(7-10)19-12-11(16)8-18-13(21-12)22-17/h4-8H,17H2,1-3H3,(H,20,23)(H2,18,19,21,22) |
| InChIKey | IESHVICFFKPSSZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|