C12H14ClN5O2 — CID 80919912
5-chloro-N-(3,5-dimethoxyphenyl)-2-hydrazinylpyrimidin-4-amine (PubChem CID 80919912) has the molecular formula C12H14ClN5O2 and a molecular weight of 295.73 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dimethoxyphenyl)-2-hydrazinylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-(3,5-dimethoxyphenyl)-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80919912 |
| Molecular Formula | C12H14ClN5O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 5-chloro-N-(3,5-dimethoxyphenyl)-2-hydrazinylpyrimidin-4-amine |
| SMILES | COc1cc(Nc2nc(NN)ncc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C12H14ClN5O2/c1-19-8-3-7(4-9(5-8)20-2)16-11-10(13)6-15-12(17-11)18-14/h3-6H,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | VHWGMQWOMSNCGU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|