C12H10ClN5O2 — CID 103568494
3-(5-chloro-2-hydrazinylpyrimidin-4-yl)oxy-5-methoxybenzonitrile (PubChem CID 103568494) has the molecular formula C12H10ClN5O2 and a molecular weight of 291.70 g/mol. Its IUPAC name is 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)oxy-5-methoxybenzonitrile.
| Compound Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)oxy-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 103568494 |
| Molecular Formula | C12H10ClN5O2 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-(5-chloro-2-hydrazinylpyrimidin-4-yl)oxy-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(Oc2nc(NN)ncc2Cl)c1 |
| InChI | InChI=1S/C12H10ClN5O2/c1-19-8-2-7(5-14)3-9(4-8)20-11-10(13)6-16-12(17-11)18-15/h2-4,6H,15H2,1H3,(H,16,17,18) |
| InChIKey | SAFXHUFFHLOHHD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|