C5H7ClN4O — CID 80911079
(5-chloro-4-methoxypyrimidin-2-yl)hydrazine (PubChem CID 80911079) has the molecular formula C5H7ClN4O and a molecular weight of 174.59 g/mol. Its IUPAC name is (5-chloro-4-methoxypyrimidin-2-yl)hydrazine.
| Compound Name | (5-chloro-4-methoxypyrimidin-2-yl)hydrazine |
|---|---|
| PubChem CID | 80911079 |
| Molecular Formula | C5H7ClN4O |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | (5-chloro-4-methoxypyrimidin-2-yl)hydrazine |
| SMILES | COc1nc(NN)ncc1Cl |
| InChI | InChI=1S/C5H7ClN4O/c1-11-4-3(6)2-8-5(9-4)10-7/h2H,7H2,1H3,(H,8,9,10) |
| InChIKey | XRLLUMNHNFOQPJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|