C12H19ClN4O — CID 80921386
[5-chloro-4-(3,5-dimethylcyclohexyl)oxypyrimidin-2-yl]hydrazine (PubChem CID 80921386) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is [5-chloro-4-(3,5-dimethylcyclohexyl)oxypyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-(3,5-dimethylcyclohexyl)oxypyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80921386 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | [5-chloro-4-(3,5-dimethylcyclohexyl)oxypyrimidin-2-yl]hydrazine |
| SMILES | CC1CC(C)CC(Oc2nc(NN)ncc2Cl)C1 |
| InChI | InChI=1S/C12H19ClN4O/c1-7-3-8(2)5-9(4-7)18-11-10(13)6-15-12(16-11)17-14/h6-9H,3-5,14H2,1-2H3,(H,15,16,17) |
| InChIKey | DKUKQXUDOMRJOP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|