C9H11ClN6O — CID 81345793
[5-chloro-4-(2,5-dimethylpyrazol-3-yl)oxypyrimidin-2-yl]hydrazine (PubChem CID 81345793) has the molecular formula C9H11ClN6O and a molecular weight of 254.68 g/mol. Its IUPAC name is [5-chloro-4-(2,5-dimethylpyrazol-3-yl)oxypyrimidin-2-yl]hydrazine.
| Compound Name | [5-chloro-4-(2,5-dimethylpyrazol-3-yl)oxypyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 81345793 |
| Molecular Formula | C9H11ClN6O |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | [5-chloro-4-(2,5-dimethylpyrazol-3-yl)oxypyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(Oc2nc(NN)ncc2Cl)n(C)n1 |
| InChI | InChI=1S/C9H11ClN6O/c1-5-3-7(16(2)15-5)17-8-6(10)4-12-9(13-8)14-11/h3-4H,11H2,1-2H3,(H,12,13,14) |
| InChIKey | VQZGKGQCCJUAJP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|