About [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine
[6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine (PubChem CID 81346637) has the molecular formula C13H20N6O
and a molecular weight of 276.34 g/mol. Its IUPAC name is [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| PubChem CID | 81346637 |
| Molecular Formula | C13H20N6O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine |
| SMILES | Cc1cc(Oc2nc(C(C)C)nc(NN)c2C)n(C)n1 |
| InChI | InChI=1S/C13H20N6O/c1-7(2)11-15-12(17-14)9(4)13(16-11)20-10-6-8(3)18-19(10)5/h6-7H,14H2,1-5H3,(H,15,16,17) |
| InChIKey | HXAYNMBZZPSZHX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine?
The IUPAC name of [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine (CID 81346637) is [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine.
What is the SMILES notation for [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine?
The canonical SMILES for [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine is Cc1cc(Oc2nc(C(C)C)nc(NN)c2C)n(C)n1.
What is the InChIKey of [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine?
The InChIKey is HXAYNMBZZPSZHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N6O/c1-7(2)11-15-12(17-14)9(4)13(16-11)20-10-6-8(3)18-19(10)5/h6-7H,14H2,1-5H3,(H,15,16,17).
What are the key properties of [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine?
[6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine has a molecular weight of 276.34 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2,5-dimethylpyrazol-3-yl)oxy-5-methyl-2-propan-2-ylpyrimidin-4-yl]hydrazine is sourced from PubChem (CID 81346637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).