About 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine
3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine (PubChem CID 102761085) has the molecular formula C11H12Cl2N4O
and a molecular weight of 287.15 g/mol. Its IUPAC name is 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine |
| PubChem CID | 102761085 |
| Molecular Formula | C11H12Cl2N4O |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine |
| SMILES | CNc1nc(Oc2cc(C)nn2C)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N4O/c1-6-4-9(17(3)16-6)18-11-8(13)5-7(12)10(14-2)15-11/h4-5H,1-3H3,(H,14,15) |
| InChIKey | JYNVMZRJBFQVJY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine?
The IUPAC name of 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine (CID 102761085) is 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine.
What is the SMILES notation for 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine?
The canonical SMILES for 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine is CNc1nc(Oc2cc(C)nn2C)c(Cl)cc1Cl.
What is the InChIKey of 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine?
The InChIKey is JYNVMZRJBFQVJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2N4O/c1-6-4-9(17(3)16-6)18-11-8(13)5-7(12)10(14-2)15-11/h4-5H,1-3H3,(H,14,15).
What are the key properties of 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine?
3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine has a molecular weight of 287.15 g/mol, XLogP of 3.26, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-6-(2,5-dimethylpyrazol-3-yl)oxy-N-methylpyridin-2-amine is sourced from PubChem (CID 102761085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).