C13H11Cl2FN2O — CID 107171841
3,5-dichloro-6-(3-fluoro-4-methylphenoxy)-N-methylpyridin-2-amine (PubChem CID 107171841) has the molecular formula C13H11Cl2FN2O and a molecular weight of 301.15 g/mol. Its IUPAC name is 3,5-dichloro-6-(3-fluoro-4-methylphenoxy)-N-methylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(3-fluoro-4-methylphenoxy)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107171841 |
| Molecular Formula | C13H11Cl2FN2O |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 3,5-dichloro-6-(3-fluoro-4-methylphenoxy)-N-methylpyridin-2-amine |
| SMILES | CNc1nc(Oc2ccc(C)c(F)c2)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2FN2O/c1-7-3-4-8(5-11(7)16)19-13-10(15)6-9(14)12(17-2)18-13/h3-6H,1-2H3,(H,17,18) |
| InChIKey | BXTKVWLJZQMNNL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |