C12H7Cl5N2O — CID 102760562
3,5-dichloro-N-methyl-6-(2,4,5-trichlorophenoxy)pyridin-2-amine (PubChem CID 102760562) has the molecular formula C12H7Cl5N2O and a molecular weight of 372.47 g/mol. Its IUPAC name is 3,5-dichloro-N-methyl-6-(2,4,5-trichlorophenoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-methyl-6-(2,4,5-trichlorophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760562 |
| Molecular Formula | C12H7Cl5N2O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 3,5-dichloro-N-methyl-6-(2,4,5-trichlorophenoxy)pyridin-2-amine |
| SMILES | CNc1nc(Oc2cc(Cl)c(Cl)cc2Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H7Cl5N2O/c1-18-11-8(16)3-9(17)12(19-11)20-10-4-6(14)5(13)2-7(10)15/h2-4H,1H3,(H,18,19) |
| InChIKey | XWYPJHLTIISGKS-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|