C13H10Cl4N2O — CID 62296357
1-[5-chloro-6-(2,4,5-trichlorophenoxy)-3-pyridinyl]-N-methylmethanamine (PubChem CID 62296357) has the molecular formula C13H10Cl4N2O and a molecular weight of 352.05 g/mol. Its IUPAC name is 1-[5-chloro-6-(2,4,5-trichlorophenoxy)-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-6-(2,4,5-trichlorophenoxy)-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62296357 |
| Molecular Formula | C13H10Cl4N2O |
| Molecular Weight | 352.05 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 1-[5-chloro-6-(2,4,5-trichlorophenoxy)-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(Oc2cc(Cl)c(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl4N2O/c1-18-5-7-2-11(17)13(19-6-7)20-12-4-9(15)8(14)3-10(12)16/h2-4,6,18H,5H2,1H3 |
| InChIKey | YPCPALZRJSHXFO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.05 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|