C13H11Cl3N2O — CID 62297762
N-methyl-1-[2-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanamine (PubChem CID 62297762) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is N-methyl-1-[2-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanamine.
| Compound Name | N-methyl-1-[2-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62297762 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | N-methyl-1-[2-(2,4,5-trichlorophenoxy)-3-pyridinyl]methanamine |
| SMILES | CNCc1cccnc1Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2O/c1-17-7-8-3-2-4-18-13(8)19-12-6-10(15)9(14)5-11(12)16/h2-6,17H,7H2,1H3 |
| InChIKey | RKHAAVBKBJQNCS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|