C12H8Cl3NO — CID 61268068
3-(chloromethyl)-2-(2,4-dichlorophenoxy)pyridine (PubChem CID 61268068) has the molecular formula C12H8Cl3NO and a molecular weight of 288.56 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2,4-dichlorophenoxy)pyridine.
| Compound Name | 3-(chloromethyl)-2-(2,4-dichlorophenoxy)pyridine |
|---|---|
| PubChem CID | 61268068 |
| Molecular Formula | C12H8Cl3NO |
| Molecular Weight | 288.56 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 3-(chloromethyl)-2-(2,4-dichlorophenoxy)pyridine |
| SMILES | ClCc1cccnc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H8Cl3NO/c13-7-8-2-1-5-16-12(8)17-11-4-3-9(14)6-10(11)15/h1-6H,7H2 |
| InChIKey | QCUCXZMFZSKNMI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|