2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride

C12H6Cl3NO2 — CID 170944074

IUPAC2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride
SMILESO=C(Cl)c1cccnc1Oc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H6Cl3NO2/c13-7-3-4-10(9(14)6-7)18-12-8(11(15)17)2-1-5-16-12/h1-6H
InChIKeyCHUDSLKUYPVITH-UHFFFAOYSA-N
MW302.54 g/mol
LogP4.56
Rot. Bonds3

About 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride

2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride (PubChem CID 170944074) has the molecular formula C12H6Cl3NO2 and a molecular weight of 302.54 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride.

Molecular Properties

Compound Name2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride
PubChem CID170944074
Molecular FormulaC12H6Cl3NO2
Molecular Weight302.54 g/mol
Exact Mass300.95
IUPAC Name2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride
SMILESO=C(Cl)c1cccnc1Oc1ccc(Cl)cc1Cl
InChIInChI=1S/C12H6Cl3NO2/c13-7-3-4-10(9(14)6-7)18-12-8(11(15)17)2-1-5-16-12/h1-6H
InChIKeyCHUDSLKUYPVITH-UHFFFAOYSA-N
XLogP4.56
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.54
LogP ≤ 54.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride?
The IUPAC name of 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride (CID 170944074) is 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride.
What is the SMILES notation for 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride?
The canonical SMILES for 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride is O=C(Cl)c1cccnc1Oc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride?
The InChIKey is CHUDSLKUYPVITH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl3NO2/c13-7-3-4-10(9(14)6-7)18-12-8(11(15)17)2-1-5-16-12/h1-6H.
What are the key properties of 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride?
2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride has a molecular weight of 302.54 g/mol, XLogP of 4.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dichlorophenoxy)pyridine-3-carbonyl chloride is sourced from PubChem (CID 170944074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).