C18H19Cl4N3O2 — CID 120659391
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-dichlorophenoxy)-3-pyridinyl]methanone;dihydrochloride (PubChem CID 120659391) has the molecular formula C18H19Cl4N3O2 and a molecular weight of 451.18 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-dichlorophenoxy)-3-pyridinyl]methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-dichlorophenoxy)-3-pyridinyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120659391 |
| Molecular Formula | C18H19Cl4N3O2 |
| Molecular Weight | 451.18 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(2,4-dichlorophenoxy)-3-pyridinyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cccnc1Oc1ccc(Cl)cc1Cl)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H17Cl2N3O2.2ClH/c19-13-3-4-16(15(20)6-13)25-17-14(2-1-5-22-17)18(24)23-9-11-7-21-8-12(11)10-23;;/h1-6,11-12,21H,7-10H2;2*1H/t11-,12+;; |
| InChIKey | RIXIVUXMCDXTQL-FYPKGCJUSA-N |
| XLogP | 4.32 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.18 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |