C18H20Cl4N4O — CID 120655431
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(3,4-dichloroanilino)-3-pyridinyl]methanone;dihydrochloride (PubChem CID 120655431) has the molecular formula C18H20Cl4N4O and a molecular weight of 450.20 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(3,4-dichloroanilino)-3-pyridinyl]methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(3,4-dichloroanilino)-3-pyridinyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120655431 |
| Molecular Formula | C18H20Cl4N4O |
| Molecular Weight | 450.20 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[2-(3,4-dichloroanilino)-3-pyridinyl]methanone;dihydrochloride |
| SMILES | Cl.Cl.O=C(c1cccnc1Nc1ccc(Cl)c(Cl)c1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C18H18Cl2N4O.2ClH/c19-15-4-3-13(6-16(15)20)23-17-14(2-1-5-22-17)18(25)24-9-11-7-21-8-12(11)10-24;;/h1-6,11-12,21H,7-10H2,(H,22,23);2*1H/t11-,12+;; |
| InChIKey | BBYDCALFUVRICD-FYPKGCJUSA-N |
| XLogP | 4.27 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.20 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |