sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate

C13H9Cl2N2NaO2 — CID 67938917

IUPACsodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate
SMILESO=C([O-])Cc1cccnc1Nc1ccc(Cl)c(Cl)c1.[Na+]
InChIInChI=1S/C13H10Cl2N2O2.Na/c14-10-4-3-9(7-11(10)15)17-13-8(6-12(18)19)2-1-5-16-13;/h1-5,7H,6H2,(H,16,17)(H,18,19);/q;+1/p-1
InChIKeyYXYHWTKKZMRFOL-UHFFFAOYSA-M
MW319.12 g/mol
LogP-0.57
Rot. Bonds4

About sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate

sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate (PubChem CID 67938917) has the molecular formula C13H9Cl2N2NaO2 and a molecular weight of 319.12 g/mol. Its IUPAC name is sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate.

Molecular Properties

Compound Namesodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate
PubChem CID67938917
Molecular FormulaC13H9Cl2N2NaO2
Molecular Weight319.12 g/mol
Exact Mass317.99
IUPAC Namesodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate
SMILESO=C([O-])Cc1cccnc1Nc1ccc(Cl)c(Cl)c1.[Na+]
InChIInChI=1S/C13H10Cl2N2O2.Na/c14-10-4-3-9(7-11(10)15)17-13-8(6-12(18)19)2-1-5-16-13;/h1-5,7H,6H2,(H,16,17)(H,18,19);/q;+1/p-1
InChIKeyYXYHWTKKZMRFOL-UHFFFAOYSA-M
XLogP-0.57
TPSA65.05 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.12
LogP ≤ 5-0.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate?
The IUPAC name of sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate (CID 67938917) is sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate.
What is the SMILES notation for sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate?
The canonical SMILES for sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate is O=C([O-])Cc1cccnc1Nc1ccc(Cl)c(Cl)c1.[Na+].
What is the InChIKey of sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate?
The InChIKey is YXYHWTKKZMRFOL-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10Cl2N2O2.Na/c14-10-4-3-9(7-11(10)15)17-13-8(6-12(18)19)2-1-5-16-13;/h1-5,7H,6H2,(H,16,17)(H,18,19);/q;+1/p-1.
What are the key properties of sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate?
sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate has a molecular weight of 319.12 g/mol, XLogP of -0.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[2-(3,4-dichloroanilino)-3-pyridinyl]acetate is sourced from PubChem (CID 67938917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).