C12H19ClN2O — CID 62296845
1-(5-chloro-6-pentoxy-3-pyridinyl)-N-methylmethanamine (PubChem CID 62296845) has the molecular formula C12H19ClN2O and a molecular weight of 242.75 g/mol. Its IUPAC name is 1-(5-chloro-6-pentoxy-3-pyridinyl)-N-methylmethanamine.
| Compound Name | 1-(5-chloro-6-pentoxy-3-pyridinyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 62296845 |
| Molecular Formula | C12H19ClN2O |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(5-chloro-6-pentoxy-3-pyridinyl)-N-methylmethanamine |
| SMILES | CCCCCOc1ncc(CNC)cc1Cl |
| InChI | InChI=1S/C12H19ClN2O/c1-3-4-5-6-16-12-11(13)7-10(8-14-2)9-15-12/h7,9,14H,3-6,8H2,1-2H3 |
| InChIKey | BXYISIGGZLKTAM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|