C11H17ClN2O — CID 62291646
1-[5-chloro-6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]-N-methylmethanamine (PubChem CID 62291646) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-[5-chloro-6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]-N-methylmethanamine.
| Compound Name | 1-[5-chloro-6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62291646 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[5-chloro-6-[(2-methylpropan-2-yl)oxy]-3-pyridinyl]-N-methylmethanamine |
| SMILES | CNCc1cnc(OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2,3)15-10-9(12)5-8(6-13-4)7-14-10/h5,7,13H,6H2,1-4H3 |
| InChIKey | DXLSENVTZDEAJU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |