C10H14Cl2N2O — CID 102760529
6-butoxy-3,5-dichloro-N-methylpyridin-2-amine (PubChem CID 102760529) has the molecular formula C10H14Cl2N2O and a molecular weight of 249.14 g/mol. Its IUPAC name is 6-butoxy-3,5-dichloro-N-methylpyridin-2-amine.
| Compound Name | 6-butoxy-3,5-dichloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 102760529 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 6-butoxy-3,5-dichloro-N-methylpyridin-2-amine |
| SMILES | CCCCOc1nc(NC)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O/c1-3-4-5-15-10-8(12)6-7(11)9(13-2)14-10/h6H,3-5H2,1-2H3,(H,13,14) |
| InChIKey | NZNIAMDFFBKDRF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|