C13H20Cl2N2O — CID 102760377
3,5-dichloro-N-ethyl-6-(4-methylpentoxy)pyridin-2-amine (PubChem CID 102760377) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-6-(4-methylpentoxy)pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-ethyl-6-(4-methylpentoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 102760377 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3,5-dichloro-N-ethyl-6-(4-methylpentoxy)pyridin-2-amine |
| SMILES | CCNc1nc(OCCCC(C)C)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N2O/c1-4-16-12-10(14)8-11(15)13(17-12)18-7-5-6-9(2)3/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | HUNBVTZNWVIBLS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|