C11H14Cl3NO — CID 102749440
2,3,5-trichloro-6-(4-methylpentoxy)pyridine (PubChem CID 102749440) has the molecular formula C11H14Cl3NO and a molecular weight of 282.60 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(4-methylpentoxy)pyridine.
| Compound Name | 2,3,5-trichloro-6-(4-methylpentoxy)pyridine |
|---|---|
| PubChem CID | 102749440 |
| Molecular Formula | C11H14Cl3NO |
| Molecular Weight | 282.60 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 2,3,5-trichloro-6-(4-methylpentoxy)pyridine |
| SMILES | CC(C)CCCOc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO/c1-7(2)4-3-5-16-11-9(13)6-8(12)10(14)15-11/h6-7H,3-5H2,1-2H3 |
| InChIKey | NOUPYTRXLXFMCX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|