C11H14Cl3NO2 — CID 106665577
2,3,5-trichloro-6-(3-methoxy-3-methylbutoxy)pyridine (PubChem CID 106665577) has the molecular formula C11H14Cl3NO2 and a molecular weight of 298.60 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(3-methoxy-3-methylbutoxy)pyridine.
| Compound Name | 2,3,5-trichloro-6-(3-methoxy-3-methylbutoxy)pyridine |
|---|---|
| PubChem CID | 106665577 |
| Molecular Formula | C11H14Cl3NO2 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2,3,5-trichloro-6-(3-methoxy-3-methylbutoxy)pyridine |
| SMILES | COC(C)(C)CCOc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl3NO2/c1-11(2,16-3)4-5-17-10-8(13)6-7(12)9(14)15-10/h6H,4-5H2,1-3H3 |
| InChIKey | BPIGHYJGXOAVPR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|