C11H12Cl2N2O — CID 106795649
6-but-3-ynoxy-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 106795649) has the molecular formula C11H12Cl2N2O and a molecular weight of 259.14 g/mol. Its IUPAC name is 6-but-3-ynoxy-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-but-3-ynoxy-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 106795649 |
| Molecular Formula | C11H12Cl2N2O |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 6-but-3-ynoxy-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | C#CCCOc1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O/c1-3-5-6-16-11-9(13)7-8(12)10(15-11)14-4-2/h1,7H,4-6H2,2H3,(H,14,15) |
| InChIKey | UBYXEWYCSJNZKW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|