C15H16Cl2N2O2 — CID 107669668
3,5-dichloro-6-(4-ethyl-2-methoxyphenoxy)-N-methylpyridin-2-amine (PubChem CID 107669668) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is 3,5-dichloro-6-(4-ethyl-2-methoxyphenoxy)-N-methylpyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(4-ethyl-2-methoxyphenoxy)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107669668 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3,5-dichloro-6-(4-ethyl-2-methoxyphenoxy)-N-methylpyridin-2-amine |
| SMILES | CCc1ccc(Oc2nc(NC)c(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C15H16Cl2N2O2/c1-4-9-5-6-12(13(7-9)20-3)21-15-11(17)8-10(16)14(18-2)19-15/h5-8H,4H2,1-3H3,(H,18,19) |
| InChIKey | MHCWRTZAXIAGAK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |