C21H22FN5O3 — CID 155926735
tert-butyl N-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]carbamate (PubChem CID 155926735) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is tert-butyl N-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 155926735 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | tert-butyl N-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Nc2ncc(F)c(Nc3cccc(O)c3)n2)c1 |
| InChI | InChI=1S/C21H22FN5O3/c1-21(2,3)30-20(29)26-14-7-4-6-13(10-14)25-19-23-12-17(22)18(27-19)24-15-8-5-9-16(28)11-15/h4-12,28H,1-3H3,(H,26,29)(H2,23,24,25,27) |
| InChIKey | PBNZAERCLKFVHE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |