C20H18FN5O3 — CID 22061087
ethyl 2-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]iminoacetate (PubChem CID 22061087) has the molecular formula C20H18FN5O3 and a molecular weight of 395.39 g/mol. Its IUPAC name is ethyl 2-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]iminoacetate.
| Compound Name | ethyl 2-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]iminoacetate |
|---|---|
| PubChem CID | 22061087 |
| Molecular Formula | C20H18FN5O3 |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | ethyl 2-[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]iminoacetate |
| SMILES | CCOC(=O)/C=N/c1cccc(Nc2ncc(F)c(Nc3cccc(O)c3)n2)c1 |
| InChI | InChI=1S/C20H18FN5O3/c1-2-29-18(28)12-22-13-5-3-6-14(9-13)25-20-23-11-17(21)19(26-20)24-15-7-4-8-16(27)10-15/h3-12,27H,2H2,1H3,(H2,23,24,25,26)/b22-12+ |
| InChIKey | KJOSLQPQPICGSG-WSDLNYQXSA-N |
| XLogP | 4.07 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|