C20H17FN6O3 — CID 91564426
2-[4-[[5-fluoro-4-[3-(2-oxoethylamino)anilino]pyrimidin-2-yl]amino]phenyl]iminoacetic acid (PubChem CID 91564426) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-[4-[[5-fluoro-4-[3-(2-oxoethylamino)anilino]pyrimidin-2-yl]amino]phenyl]iminoacetic acid.
| Compound Name | 2-[4-[[5-fluoro-4-[3-(2-oxoethylamino)anilino]pyrimidin-2-yl]amino]phenyl]iminoacetic acid |
|---|---|
| PubChem CID | 91564426 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[4-[[5-fluoro-4-[3-(2-oxoethylamino)anilino]pyrimidin-2-yl]amino]phenyl]iminoacetic acid |
| SMILES | O=CCNc1cccc(Nc2nc(Nc3ccc(/N=C/C(=O)O)cc3)ncc2F)c1 |
| InChI | InChI=1S/C20H17FN6O3/c21-17-11-24-20(26-14-6-4-13(5-7-14)23-12-18(29)30)27-19(17)25-16-3-1-2-15(10-16)22-8-9-28/h1-7,9-12,22H,8H2,(H,29,30)(H2,24,25,26,27)/b23-12+ |
| InChIKey | QVIQSNBTVYWDOM-FSJBWODESA-N |
| XLogP | 3.50 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|