C24H27FN8O2 — CID 66762369
2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-1-piperazin-1-ylethanone (PubChem CID 66762369) has the molecular formula C24H27FN8O2 and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-1-piperazin-1-ylethanone.
| Compound Name | 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-1-piperazin-1-ylethanone |
|---|---|
| PubChem CID | 66762369 |
| Molecular Formula | C24H27FN8O2 |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-1-piperazin-1-ylethanone |
| SMILES | O=C(/C=N/c1cccc(Nc2ncc(F)c(Nc3cccc(NCCO)c3)n2)c1)N1CCNCC1 |
| InChI | InChI=1S/C24H27FN8O2/c25-21-15-29-24(32-23(21)30-19-5-1-3-17(13-19)27-9-12-34)31-20-6-2-4-18(14-20)28-16-22(35)33-10-7-26-8-11-33/h1-6,13-16,26-27,34H,7-12H2,(H2,29,30,31,32)/b28-16+ |
| InChIKey | SDPOVYHXTRBCAD-LQKURTRISA-N |
| XLogP | 2.64 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|