C23H27FN8O2 — CID 22060541
2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-N-[2-(methylamino)ethyl]acetamide (PubChem CID 22060541) has the molecular formula C23H27FN8O2 and a molecular weight of 466.52 g/mol. Its IUPAC name is 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-N-[2-(methylamino)ethyl]acetamide.
| Compound Name | 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-N-[2-(methylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 22060541 |
| Molecular Formula | C23H27FN8O2 |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 2-[3-[[5-fluoro-4-[3-(2-hydroxyethylamino)anilino]pyrimidin-2-yl]amino]phenyl]imino-N-[2-(methylamino)ethyl]acetamide |
| SMILES | CNCCNC(=O)/C=N/c1cccc(Nc2ncc(F)c(Nc3cccc(NCCO)c3)n2)c1 |
| InChI | InChI=1S/C23H27FN8O2/c1-25-8-9-27-21(34)15-28-17-5-3-7-19(13-17)31-23-29-14-20(24)22(32-23)30-18-6-2-4-16(12-18)26-10-11-33/h2-7,12-15,25-26,33H,8-11H2,1H3,(H,27,34)(H2,29,30,31,32)/b28-15+ |
| InChIKey | SCPIHQCFAZIIKV-RWPZCVJISA-N |
| XLogP | 2.55 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|