C21H20FN5O3 — CID 22060666
[3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]-morpholin-4-ylmethanone (PubChem CID 22060666) has the molecular formula C21H20FN5O3 and a molecular weight of 409.42 g/mol. Its IUPAC name is [3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 22060666 |
| Molecular Formula | C21H20FN5O3 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | [3-[[5-fluoro-4-(3-hydroxyanilino)pyrimidin-2-yl]amino]phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cccc(Nc2ncc(F)c(Nc3cccc(O)c3)n2)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H20FN5O3/c22-18-13-23-21(26-19(18)24-16-5-2-6-17(28)12-16)25-15-4-1-3-14(11-15)20(29)27-7-9-30-10-8-27/h1-6,11-13,28H,7-10H2,(H2,23,24,25,26) |
| InChIKey | GNJAODPPIBAPQU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |