C21H21FN6O3 — CID 175329947
3-[[5-fluoro-2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-hydroxybenzamide (PubChem CID 175329947) has the molecular formula C21H21FN6O3 and a molecular weight of 424.44 g/mol. Its IUPAC name is 3-[[5-fluoro-2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-hydroxybenzamide.
| Compound Name | 3-[[5-fluoro-2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 175329947 |
| Molecular Formula | C21H21FN6O3 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[[5-fluoro-2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cccc(Nc2nc(Nc3ccccc3N3CCOCC3)ncc2F)c1 |
| InChI | InChI=1S/C21H21FN6O3/c22-16-13-23-21(25-17-6-1-2-7-18(17)28-8-10-31-11-9-28)26-19(16)24-15-5-3-4-14(12-15)20(29)27-30/h1-7,12-13,30H,8-11H2,(H,27,29)(H2,23,24,25,26) |
| InChIKey | FEOKDSBXQARCLC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|