C22H23N5O2 — CID 112905634
1-[3-[[4-(2-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenyl]ethanone (PubChem CID 112905634) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[3-[[4-(2-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[4-(2-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112905634 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 1-[3-[[4-(2-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2nccc(Nc3ccccc3N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C22H23N5O2/c1-16(28)17-5-4-6-18(15-17)24-22-23-10-9-21(26-22)25-19-7-2-3-8-20(19)27-11-13-29-14-12-27/h2-10,15H,11-14H2,1H3,(H2,23,24,25,26) |
| InChIKey | PDFVWODYGODIOO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |