C18H23N5O2 — CID 112886633
2-morpholin-4-yl-N-(2-morpholin-4-ylphenyl)pyrimidin-4-amine (PubChem CID 112886633) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(2-morpholin-4-ylphenyl)pyrimidin-4-amine.
| Compound Name | 2-morpholin-4-yl-N-(2-morpholin-4-ylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112886633 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2-morpholin-4-yl-N-(2-morpholin-4-ylphenyl)pyrimidin-4-amine |
| SMILES | c1ccc(N2CCOCC2)c(Nc2ccnc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C18H23N5O2/c1-2-4-16(22-7-11-24-12-8-22)15(3-1)20-17-5-6-19-18(21-17)23-9-13-25-14-10-23/h1-6H,7-14H2,(H,19,20,21) |
| InChIKey | STVZEIVDOBRAQE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |