C20H27N5O — CID 112885027
2-N-cyclohexyl-4-N-(2-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 112885027) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-(2-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-4-N-(2-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112885027 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-N-cyclohexyl-4-N-(2-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | c1ccc(N2CCOCC2)c(Nc2ccnc(NC3CCCCC3)n2)c1 |
| InChI | InChI=1S/C20H27N5O/c1-2-6-16(7-3-1)22-20-21-11-10-19(24-20)23-17-8-4-5-9-18(17)25-12-14-26-15-13-25/h4-5,8-11,16H,1-3,6-7,12-15H2,(H2,21,22,23,24) |
| InChIKey | LFYJQRSWSOUIFZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |