C21H27N5O2 — CID 109250604
2-(cyclohexylamino)-N-(2-morpholin-4-ylphenyl)pyrimidine-5-carboxamide (PubChem CID 109250604) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-(2-morpholin-4-ylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-(2-morpholin-4-ylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109250604 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 2-(cyclohexylamino)-N-(2-morpholin-4-ylphenyl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)c1cnc(NC2CCCCC2)nc1 |
| InChI | InChI=1S/C21H27N5O2/c27-20(16-14-22-21(23-15-16)24-17-6-2-1-3-7-17)25-18-8-4-5-9-19(18)26-10-12-28-13-11-26/h4-5,8-9,14-15,17H,1-3,6-7,10-13H2,(H,25,27)(H,22,23,24) |
| InChIKey | WSMIABXLSICFIO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |