C21H21N5O3 — CID 113194788
2-[[2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 113194788) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[[2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 2-[[2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 113194788 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[[2-(2-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1Nc1ccnc(Nc2ccccc2N2CCOCC2)n1 |
| InChI | InChI=1S/C21H21N5O3/c27-20(28)15-5-1-2-6-16(15)23-19-9-10-22-21(25-19)24-17-7-3-4-8-18(17)26-11-13-29-14-12-26/h1-10H,11-14H2,(H,27,28)(H2,22,23,24,25) |
| InChIKey | KUMBRMGRVJNWHW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |